C16H25FN2 — CID 117016000
7-fluoro-3,3-dimethyl-1-pentyl-4,5-dihydro-2H-1,5-benzodiazepine (PubChem CID 117016000) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 7-fluoro-3,3-dimethyl-1-pentyl-4,5-dihydro-2H-1,5-benzodiazepine.
| Compound Name | 7-fluoro-3,3-dimethyl-1-pentyl-4,5-dihydro-2H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 117016000 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 7-fluoro-3,3-dimethyl-1-pentyl-4,5-dihydro-2H-1,5-benzodiazepine |
| SMILES | CCCCCN1CC(C)(C)CNc2cc(F)ccc21 |
| InChI | InChI=1S/C16H25FN2/c1-4-5-6-9-19-12-16(2,3)11-18-14-10-13(17)7-8-15(14)19/h7-8,10,18H,4-6,9,11-12H2,1-3H3 |
| InChIKey | WOEYXSONHXPMTQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|