C12H20F3N3O — CID 115101418
4-[(1-ethylpyrrolidin-2-yl)methyl]-5-(trifluoromethyl)piperazin-2-one (PubChem CID 115101418) has the molecular formula C12H20F3N3O and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-[(1-ethylpyrrolidin-2-yl)methyl]-5-(trifluoromethyl)piperazin-2-one.
| Compound Name | 4-[(1-ethylpyrrolidin-2-yl)methyl]-5-(trifluoromethyl)piperazin-2-one |
|---|---|
| PubChem CID | 115101418 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-[(1-ethylpyrrolidin-2-yl)methyl]-5-(trifluoromethyl)piperazin-2-one |
| SMILES | CCN1CCCC1CN1CC(=O)NCC1C(F)(F)F |
| InChI | InChI=1S/C12H20F3N3O/c1-2-17-5-3-4-9(17)7-18-8-11(19)16-6-10(18)12(13,14)15/h9-10H,2-8H2,1H3,(H,16,19) |
| InChIKey | LPSMMRHGCATVHA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |