C9H16N2OS — CID 115101837
1-(thiolan-2-yl)-1,4-diazepan-2-one (PubChem CID 115101837) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 1-(thiolan-2-yl)-1,4-diazepan-2-one.
| Compound Name | 1-(thiolan-2-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 115101837 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(thiolan-2-yl)-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1C1CCCS1 |
| InChI | InChI=1S/C9H16N2OS/c12-8-7-10-4-2-5-11(8)9-3-1-6-13-9/h9-10H,1-7H2 |
| InChIKey | AWMBTRQNYFTPGP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |