C9H16N2O2 — CID 115102162
3-methyl-1-(2-oxopropyl)-1,4-diazepan-2-one (PubChem CID 115102162) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-methyl-1-(2-oxopropyl)-1,4-diazepan-2-one.
| Compound Name | 3-methyl-1-(2-oxopropyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 115102162 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-methyl-1-(2-oxopropyl)-1,4-diazepan-2-one |
| SMILES | CC(=O)CN1CCCNC(C)C1=O |
| InChI | InChI=1S/C9H16N2O2/c1-7(12)6-11-5-3-4-10-8(2)9(11)13/h8,10H,3-6H2,1-2H3 |
| InChIKey | FDSYOQMMWDHGCN-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |