About 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one
3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one (PubChem CID 83160675) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one |
| PubChem CID | 83160675 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one |
| SMILES | CC(C)CCCN1CCCNC(C)C1=O |
| InChI | InChI=1S/C12H24N2O/c1-10(2)6-4-8-14-9-5-7-13-11(3)12(14)15/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | HGRLBSCGZWQFRO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one?
The IUPAC name of 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one (CID 83160675) is 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one.
What is the SMILES notation for 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one?
The canonical SMILES for 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one is CC(C)CCCN1CCCNC(C)C1=O.
What is the InChIKey of 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one?
The InChIKey is HGRLBSCGZWQFRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-10(2)6-4-8-14-9-5-7-13-11(3)12(14)15/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one?
3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one has a molecular weight of 212.34 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(4-methylpentyl)-1,4-diazepan-2-one is sourced from PubChem (CID 83160675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).