C14H25N3O2 — CID 63258592
N-cyclohexyl-2-(3-methyl-2-oxo-1,4-diazepan-1-yl)acetamide (PubChem CID 63258592) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-methyl-2-oxo-1,4-diazepan-1-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(3-methyl-2-oxo-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 63258592 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-cyclohexyl-2-(3-methyl-2-oxo-1,4-diazepan-1-yl)acetamide |
| SMILES | CC1NCCCN(CC(=O)NC2CCCCC2)C1=O |
| InChI | InChI=1S/C14H25N3O2/c1-11-14(19)17(9-5-8-15-11)10-13(18)16-12-6-3-2-4-7-12/h11-12,15H,2-10H2,1H3,(H,16,18) |
| InChIKey | YVXKGRKROAYSDP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |