C14H20N2 — CID 115105607
[1-(cyclobutylmethyl)-2,3-dihydroindol-7-yl]methanamine (PubChem CID 115105607) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is [1-(cyclobutylmethyl)-2,3-dihydroindol-7-yl]methanamine.
| Compound Name | [1-(cyclobutylmethyl)-2,3-dihydroindol-7-yl]methanamine |
|---|---|
| PubChem CID | 115105607 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | [1-(cyclobutylmethyl)-2,3-dihydroindol-7-yl]methanamine |
| SMILES | NCc1cccc2c1N(CC1CCC1)CC2 |
| InChI | InChI=1S/C14H20N2/c15-9-13-6-2-5-12-7-8-16(14(12)13)10-11-3-1-4-11/h2,5-6,11H,1,3-4,7-10,15H2 |
| InChIKey | XAFQSDDDNBUZTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |