C14H17NO — CID 115105685
1-(cyclobutylmethyl)-2,3-dihydroindole-7-carbaldehyde (PubChem CID 115105685) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2,3-dihydroindole-7-carbaldehyde.
| Compound Name | 1-(cyclobutylmethyl)-2,3-dihydroindole-7-carbaldehyde |
|---|---|
| PubChem CID | 115105685 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-(cyclobutylmethyl)-2,3-dihydroindole-7-carbaldehyde |
| SMILES | O=Cc1cccc2c1N(CC1CCC1)CC2 |
| InChI | InChI=1S/C14H17NO/c16-10-13-6-2-5-12-7-8-15(14(12)13)9-11-3-1-4-11/h2,5-6,10-11H,1,3-4,7-9H2 |
| InChIKey | WFPWLWNAISIDLD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|