C13H7F3N2O2S — CID 115109546
5-[6-(trifluoromethyl)-1-benzothiophen-2-yl]-1H-pyrazole-4-carboxylic acid (PubChem CID 115109546) has the molecular formula C13H7F3N2O2S and a molecular weight of 312.27 g/mol. Its IUPAC name is 5-[6-(trifluoromethyl)-1-benzothiophen-2-yl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[6-(trifluoromethyl)-1-benzothiophen-2-yl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115109546 |
| Molecular Formula | C13H7F3N2O2S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 5-[6-(trifluoromethyl)-1-benzothiophen-2-yl]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1-c1cc2ccc(C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C13H7F3N2O2S/c14-13(15,16)7-2-1-6-3-10(21-9(6)4-7)11-8(12(19)20)5-17-18-11/h1-5H,(H,17,18)(H,19,20) |
| InChIKey | PUDZECHGJNPOQA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |