C16H9F3O2S — CID 142727871
6-[4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 142727871) has the molecular formula C16H9F3O2S and a molecular weight of 322.31 g/mol. Its IUPAC name is 6-[4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 6-[4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 142727871 |
| Molecular Formula | C16H9F3O2S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-[4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccc(-c3ccc(C(F)(F)F)cc3)cc2s1 |
| InChI | InChI=1S/C16H9F3O2S/c17-16(18,19)12-5-3-9(4-6-12)10-1-2-11-8-14(15(20)21)22-13(11)7-10/h1-8H,(H,20,21) |
| InChIKey | ZFJMIILFASGLHE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |