C15H14N2O3 — CID 115110289
5-(7-methoxy-1H-indol-3-yl)-1-methylpyrrole-2-carboxylic acid (PubChem CID 115110289) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-(7-methoxy-1H-indol-3-yl)-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 5-(7-methoxy-1H-indol-3-yl)-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 115110289 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-(7-methoxy-1H-indol-3-yl)-1-methylpyrrole-2-carboxylic acid |
| SMILES | COc1cccc2c(-c3ccc(C(=O)O)n3C)c[nH]c12 |
| InChI | InChI=1S/C15H14N2O3/c1-17-11(6-7-12(17)15(18)19)10-8-16-14-9(10)4-3-5-13(14)20-2/h3-8,16H,1-2H3,(H,18,19) |
| InChIKey | VPZGUGAFLVRBAN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |