C23H31ClN2O4S — CID 11511063
[(2S,3S,11bS)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl] methanesulfonate;hydrochloride (PubChem CID 11511063) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is [(2S,3S,11bS)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl] methanesulfonate;hydrochloride.
| Compound Name | [(2S,3S,11bS)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 11511063 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [(2S,3S,11bS)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl] methanesulfonate;hydrochloride |
| SMILES | COc1cc2c(cc1OS(C)(=O)=O)CCN1C[C@H](c3cc(C)ccc3C)[C@@H](N)C[C@@H]21.Cl |
| InChI | InChI=1S/C23H30N2O4S.ClH/c1-14-5-6-15(2)17(9-14)19-13-25-8-7-16-10-23(29-30(4,26)27)22(28-3)11-18(16)21(25)12-20(19)24;/h5-6,9-11,19-21H,7-8,12-13,24H2,1-4H3;1H/t19-,20+,21+;/m1./s1 |
| InChIKey | ZHWYOCPVRUYKBQ-CCXMUWKTSA-N |
| XLogP | 3.49 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|