C29H41N3O4 — CID 142689181
tert-butyl N-[2-[[(2S,3R,11bR)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]ethyl]carbamate (PubChem CID 142689181) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S,3R,11bR)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S,3R,11bR)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142689181 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | tert-butyl N-[2-[[(2S,3R,11bR)-2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]ethyl]carbamate |
| SMILES | COc1cc2c(cc1OCCNC(=O)OC(C)(C)C)CCN1C[C@@H](c3cc(C)ccc3C)[C@@H](N)C[C@H]21 |
| InChI | InChI=1S/C29H41N3O4/c1-18-7-8-19(2)21(13-18)23-17-32-11-9-20-14-27(35-12-10-31-28(33)36-29(3,4)5)26(34-6)15-22(20)25(32)16-24(23)30/h7-8,13-15,23-25H,9-12,16-17,30H2,1-6H3,(H,31,33)/t23-,24-,25+/m0/s1 |
| InChIKey | GTTUEMOGRWCVAT-CCDWMCETSA-N |
| XLogP | 4.63 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|