C25H38ClN3O5 — CID 68622299
tert-butyl N-[3-(4-chloropentanoylamino)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate (PubChem CID 68622299) has the molecular formula C25H38ClN3O5 and a molecular weight of 496.05 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloropentanoylamino)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloropentanoylamino)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate |
|---|---|
| PubChem CID | 68622299 |
| Molecular Formula | C25H38ClN3O5 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | tert-butyl N-[3-(4-chloropentanoylamino)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate |
| SMILES | COc1cc2c(cc1OC)C1CC(NC(=O)OC(C)(C)C)C(NC(=O)CCC(C)Cl)CN1CC2 |
| InChI | InChI=1S/C25H38ClN3O5/c1-15(26)7-8-23(30)27-19-14-29-10-9-16-11-21(32-5)22(33-6)12-17(16)20(29)13-18(19)28-24(31)34-25(2,3)4/h11-12,15,18-20H,7-10,13-14H2,1-6H3,(H,27,30)(H,28,31) |
| InChIKey | VYHPZLTXSDPFFC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|