C26H39N3O5 — CID 68620901
tert-butyl N-[9,10-dimethoxy-3-(5-methyl-2-oxopiperidin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate (PubChem CID 68620901) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is tert-butyl N-[9,10-dimethoxy-3-(5-methyl-2-oxopiperidin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate.
| Compound Name | tert-butyl N-[9,10-dimethoxy-3-(5-methyl-2-oxopiperidin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate |
|---|---|
| PubChem CID | 68620901 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | tert-butyl N-[9,10-dimethoxy-3-(5-methyl-2-oxopiperidin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate |
| SMILES | COc1cc2c(cc1OC)C1CC(NC(=O)OC(C)(C)C)C(N3CC(C)CCC3=O)CN1CC2 |
| InChI | InChI=1S/C26H39N3O5/c1-16-7-8-24(30)29(14-16)21-15-28-10-9-17-11-22(32-5)23(33-6)12-18(17)20(28)13-19(21)27-25(31)34-26(2,3)4/h11-12,16,19-21H,7-10,13-15H2,1-6H3,(H,27,31) |
| InChIKey | ZTZJSXAMOSLHHY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |