C25H35N3O5 — CID 68621897
tert-butyl N-[9,10-dimethoxy-3-(6-oxo-2,3-dihydropyridin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate (PubChem CID 68621897) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl N-[9,10-dimethoxy-3-(6-oxo-2,3-dihydropyridin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate.
| Compound Name | tert-butyl N-[9,10-dimethoxy-3-(6-oxo-2,3-dihydropyridin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate |
|---|---|
| PubChem CID | 68621897 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl N-[9,10-dimethoxy-3-(6-oxo-2,3-dihydropyridin-1-yl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]carbamate |
| SMILES | COc1cc2c(cc1OC)C1CC(NC(=O)OC(C)(C)C)C(N3CCC=CC3=O)CN1CC2 |
| InChI | InChI=1S/C25H35N3O5/c1-25(2,3)33-24(30)26-18-14-19-17-13-22(32-5)21(31-4)12-16(17)9-11-27(19)15-20(18)28-10-7-6-8-23(28)29/h6,8,12-13,18-20H,7,9-11,14-15H2,1-5H3,(H,26,30) |
| InChIKey | AFPLICIVHRUFHI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |