C25H34ClN3O3 — CID 57465191
2-[[2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]-N-methylacetamide;hydrochloride (PubChem CID 57465191) has the molecular formula C25H34ClN3O3 and a molecular weight of 460.02 g/mol. Its IUPAC name is 2-[[2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]-N-methylacetamide;hydrochloride.
| Compound Name | 2-[[2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 57465191 |
| Molecular Formula | C25H34ClN3O3 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[[2-amino-3-(2,5-dimethylphenyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]-N-methylacetamide;hydrochloride |
| SMILES | CNC(=O)COc1cc2c(cc1OC)C1CC(N)C(c3cc(C)ccc3C)CN1CC2.Cl |
| InChI | InChI=1S/C25H33N3O3.ClH/c1-15-5-6-16(2)18(9-15)20-13-28-8-7-17-10-24(31-14-25(29)27-3)23(30-4)11-19(17)22(28)12-21(20)26;/h5-6,9-11,20-22H,7-8,12-14,26H2,1-4H3,(H,27,29);1H |
| InChIKey | NPDDQCZERZZHBU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |