C12H12BrN3O2 — CID 115114709
5-(aminomethyl)-1-[(2-bromophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 115114709) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[(2-bromophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-(aminomethyl)-1-[(2-bromophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115114709 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 5-(aminomethyl)-1-[(2-bromophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | NCc1cn(Cc2ccccc2Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H12BrN3O2/c13-10-4-2-1-3-8(10)6-16-7-9(5-14)11(17)15-12(16)18/h1-4,7H,5-6,14H2,(H,15,17,18) |
| InChIKey | VPLNLEHXFCRDRZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |