C10H17ClN2OS — CID 115120936
2-amino-3-[2-(5-chlorothiophen-2-yl)ethyl-methylamino]propan-1-ol (PubChem CID 115120936) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is 2-amino-3-[2-(5-chlorothiophen-2-yl)ethyl-methylamino]propan-1-ol.
| Compound Name | 2-amino-3-[2-(5-chlorothiophen-2-yl)ethyl-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 115120936 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-amino-3-[2-(5-chlorothiophen-2-yl)ethyl-methylamino]propan-1-ol |
| SMILES | CN(CCc1ccc(Cl)s1)CC(N)CO |
| InChI | InChI=1S/C10H17ClN2OS/c1-13(6-8(12)7-14)5-4-9-2-3-10(11)15-9/h2-3,8,14H,4-7,12H2,1H3 |
| InChIKey | IHZLUKPKIAZORR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |