About N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine
N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine (PubChem CID 115226192) has the molecular formula C8H13ClN2S
and a molecular weight of 204.73 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine |
| PubChem CID | 115226192 |
| Molecular Formula | C8H13ClN2S |
| Molecular Weight | 204.73 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine |
| SMILES | CN(CN)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2S/c1-11(6-10)5-4-7-2-3-8(9)12-7/h2-3H,4-6,10H2,1H3 |
| InChIKey | DPXNXXSDKCUBAL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.73 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine?
The IUPAC name of N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine (CID 115226192) is N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine.
What is the SMILES notation for N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine?
The canonical SMILES for N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine is CN(CN)CCc1ccc(Cl)s1.
What is the InChIKey of N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine?
The InChIKey is DPXNXXSDKCUBAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2S/c1-11(6-10)5-4-7-2-3-8(9)12-7/h2-3H,4-6,10H2,1H3.
What are the key properties of N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine?
N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine has a molecular weight of 204.73 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methylmethanediamine is sourced from PubChem (CID 115226192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).