C35H29NO3S — CID 11512249
(E)-1-[1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-3,6-dihydro-2H-pyridin-5-yl]-3-naphthalen-1-ylprop-2-en-1-one (PubChem CID 11512249) has the molecular formula C35H29NO3S and a molecular weight of 543.69 g/mol. Its IUPAC name is (E)-1-[1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-3,6-dihydro-2H-pyridin-5-yl]-3-naphthalen-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-[1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-3,6-dihydro-2H-pyridin-5-yl]-3-naphthalen-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 11512249 |
| Molecular Formula | C35H29NO3S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (E)-1-[1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-3,6-dihydro-2H-pyridin-5-yl]-3-naphthalen-1-ylprop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)/C=C/c3cccc4ccccc34)=CCC2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C35H29NO3S/c1-25-16-20-30(21-17-25)40(38,39)36-24-29(18-22-34(36)33-15-7-12-27-9-3-5-14-32(27)33)35(37)23-19-28-11-6-10-26-8-2-4-13-31(26)28/h2-21,23,34H,22,24H2,1H3/b23-19+ |
| InChIKey | UIEYNDVMALMVTI-FCDQGJHFSA-N |
| XLogP | 7.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|