C15H14BrN3O — CID 115125297
6-amino-1-(2-amino-4-bromophenyl)-3,4-dihydroquinolin-2-one (PubChem CID 115125297) has the molecular formula C15H14BrN3O and a molecular weight of 332.20 g/mol. Its IUPAC name is 6-amino-1-(2-amino-4-bromophenyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-(2-amino-4-bromophenyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 115125297 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 6-amino-1-(2-amino-4-bromophenyl)-3,4-dihydroquinolin-2-one |
| SMILES | Nc1ccc2c(c1)CCC(=O)N2c1ccc(Br)cc1N |
| InChI | InChI=1S/C15H14BrN3O/c16-10-2-4-14(12(18)8-10)19-13-5-3-11(17)7-9(13)1-6-15(19)20/h2-5,7-8H,1,6,17-18H2 |
| InChIKey | YBVVOWGFVORZGM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|