C11H12FN3 — CID 115125688
3-fluoro-2-N-methyl-2-N-(1H-pyrrol-3-yl)benzene-1,2-diamine (PubChem CID 115125688) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 3-fluoro-2-N-methyl-2-N-(1H-pyrrol-3-yl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-2-N-methyl-2-N-(1H-pyrrol-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115125688 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 3-fluoro-2-N-methyl-2-N-(1H-pyrrol-3-yl)benzene-1,2-diamine |
| SMILES | CN(c1cc[nH]c1)c1c(N)cccc1F |
| InChI | InChI=1S/C11H12FN3/c1-15(8-5-6-14-7-8)11-9(12)3-2-4-10(11)13/h2-7,14H,13H2,1H3 |
| InChIKey | BHJLGQLBDXBDLJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|