C14H14F2N2 — CID 115126009
2-N-(3,4-difluorophenyl)-2-N,3-dimethylbenzene-1,2-diamine (PubChem CID 115126009) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-N-(3,4-difluorophenyl)-2-N,3-dimethylbenzene-1,2-diamine.
| Compound Name | 2-N-(3,4-difluorophenyl)-2-N,3-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115126009 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-N-(3,4-difluorophenyl)-2-N,3-dimethylbenzene-1,2-diamine |
| SMILES | Cc1cccc(N)c1N(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H14F2N2/c1-9-4-3-5-13(17)14(9)18(2)10-6-7-11(15)12(16)8-10/h3-8H,17H2,1-2H3 |
| InChIKey | BZSVARMLBIGVTH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|