C9H13FN2O — CID 130526445
2-N-ethyl-3-fluoro-2-N-methoxybenzene-1,2-diamine (PubChem CID 130526445) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is 2-N-ethyl-3-fluoro-2-N-methoxybenzene-1,2-diamine.
| Compound Name | 2-N-ethyl-3-fluoro-2-N-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 130526445 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-N-ethyl-3-fluoro-2-N-methoxybenzene-1,2-diamine |
| SMILES | CCN(OC)c1c(N)cccc1F |
| InChI | InChI=1S/C9H13FN2O/c1-3-12(13-2)9-7(10)5-4-6-8(9)11/h4-6H,3,11H2,1-2H3 |
| InChIKey | ZXJSYIOICPGLQQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|