C18H20N4O4S — CID 1151278
N-(3-methoxypyrazin-2-yl)-4-[[(E)-(2-oxocyclohexylidene)methyl]amino]benzenesulfonamide (PubChem CID 1151278) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(3-methoxypyrazin-2-yl)-4-[[(E)-(2-oxocyclohexylidene)methyl]amino]benzenesulfonamide.
| Compound Name | N-(3-methoxypyrazin-2-yl)-4-[[(E)-(2-oxocyclohexylidene)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 1151278 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-(3-methoxypyrazin-2-yl)-4-[[(E)-(2-oxocyclohexylidene)methyl]amino]benzenesulfonamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(N/C=C2\CCCCC2=O)cc1 |
| InChI | InChI=1S/C18H20N4O4S/c1-26-18-17(19-10-11-20-18)22-27(24,25)15-8-6-14(7-9-15)21-12-13-4-2-3-5-16(13)23/h6-12,21H,2-5H2,1H3,(H,19,22)/b13-12+ |
| InChIKey | GIIPQKDSEMIYBO-OUKQBFOZSA-N |
| XLogP | 2.72 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|