C19H19N5O6S2 — CID 2193649
N-[4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 2193649) has the molecular formula C19H19N5O6S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2193649 |
| Molecular Formula | C19H19N5O6S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H19N5O6S2/c1-13(25)22-14-3-7-16(8-4-14)31(26,27)23-15-5-9-17(10-6-15)32(28,29)24-18-19(30-2)21-12-11-20-18/h3-12,23H,1-2H3,(H,20,24)(H,22,25) |
| InChIKey | YOXKZWYAQYUILS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |