C19H16FN5O4S2 — CID 3117870
2-fluoro-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 3117870) has the molecular formula C19H16FN5O4S2 and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-fluoro-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-fluoro-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3117870 |
| Molecular Formula | C19H16FN5O4S2 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-fluoro-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H16FN5O4S2/c1-29-18-16(21-10-11-22-18)25-31(27,28)13-8-6-12(7-9-13)23-19(30)24-17(26)14-4-2-3-5-15(14)20/h2-11H,1H3,(H,21,25)(H2,23,24,26,30) |
| InChIKey | BXOZJPQJQAVKEA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|