C11H12Cl2N2 — CID 115130451
2-[2-(3,4-dichlorophenyl)ethylamino]propanenitrile (PubChem CID 115130451) has the molecular formula C11H12Cl2N2 and a molecular weight of 243.14 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)ethylamino]propanenitrile.
| Compound Name | 2-[2-(3,4-dichlorophenyl)ethylamino]propanenitrile |
|---|---|
| PubChem CID | 115130451 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)ethylamino]propanenitrile |
| SMILES | CC(C#N)NCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2/c1-8(7-14)15-5-4-9-2-3-10(12)11(13)6-9/h2-3,6,8,15H,4-5H2,1H3 |
| InChIKey | QMDNFAPEAKLZTE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |