C14H23NO3 — CID 115137309
2-(2,4-dimethoxy-3-methylanilino)-3-methylbutan-1-ol (PubChem CID 115137309) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-3-methylanilino)-3-methylbutan-1-ol.
| Compound Name | 2-(2,4-dimethoxy-3-methylanilino)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 115137309 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-(2,4-dimethoxy-3-methylanilino)-3-methylbutan-1-ol |
| SMILES | COc1ccc(NC(CO)C(C)C)c(OC)c1C |
| InChI | InChI=1S/C14H23NO3/c1-9(2)12(8-16)15-11-6-7-13(17-4)10(3)14(11)18-5/h6-7,9,12,15-16H,8H2,1-5H3 |
| InChIKey | DGDKZXSJBAJNFI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|