C14H24O2 — CID 11514102
(Z)-7-methyl-3-pentyloct-3-en-5-yne-2,7-diol (PubChem CID 11514102) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (Z)-7-methyl-3-pentyloct-3-en-5-yne-2,7-diol.
| Compound Name | (Z)-7-methyl-3-pentyloct-3-en-5-yne-2,7-diol |
|---|---|
| PubChem CID | 11514102 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (Z)-7-methyl-3-pentyloct-3-en-5-yne-2,7-diol |
| SMILES | CCCCC/C(=C/C#CC(C)(C)O)C(C)O |
| InChI | InChI=1S/C14H24O2/c1-5-6-7-9-13(12(2)15)10-8-11-14(3,4)16/h10,12,15-16H,5-7,9H2,1-4H3/b13-10- |
| InChIKey | HXJDWPUOSMVUNN-RAXLEYEMSA-N |
| XLogP | 2.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|