C12H13N3O4 — CID 115141927
ethyl 2-[methyl-(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]-2-oxoacetate (PubChem CID 115141927) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is ethyl 2-[methyl-(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[methyl-(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 115141927 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | ethyl 2-[methyl-(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(C)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H13N3O4/c1-3-19-11(17)10(16)15(2)7-4-5-8-9(6-7)14-12(18)13-8/h4-6H,3H2,1-2H3,(H2,13,14,18) |
| InChIKey | NKRDCTNVXFVZIU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|