C9H13N5O — CID 115260667
5-[hydrazinylmethyl(methyl)amino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 115260667) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 5-[hydrazinylmethyl(methyl)amino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[hydrazinylmethyl(methyl)amino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 115260667 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 5-[hydrazinylmethyl(methyl)amino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CN(CNN)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H13N5O/c1-14(5-11-10)6-2-3-7-8(4-6)13-9(15)12-7/h2-4,11H,5,10H2,1H3,(H2,12,13,15) |
| InChIKey | RJDWWLAIBBLPGE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|