C14H25N3 — CID 115145619
N,2,2-trimethyl-N-[2-(1H-pyrrol-3-yl)ethyl]piperidin-4-amine (PubChem CID 115145619) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[2-(1H-pyrrol-3-yl)ethyl]piperidin-4-amine.
| Compound Name | N,2,2-trimethyl-N-[2-(1H-pyrrol-3-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 115145619 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N,2,2-trimethyl-N-[2-(1H-pyrrol-3-yl)ethyl]piperidin-4-amine |
| SMILES | CN(CCc1cc[nH]c1)C1CCNC(C)(C)C1 |
| InChI | InChI=1S/C14H25N3/c1-14(2)10-13(5-8-16-14)17(3)9-6-12-4-7-15-11-12/h4,7,11,13,15-16H,5-6,8-10H2,1-3H3 |
| InChIKey | KHTKRZSJNIJLOC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |