C14H23ClN2 — CID 156708950
N,2,2-trimethyl-N-phenylpiperidin-4-amine;hydrochloride (PubChem CID 156708950) has the molecular formula C14H23ClN2 and a molecular weight of 254.81 g/mol. Its IUPAC name is N,2,2-trimethyl-N-phenylpiperidin-4-amine;hydrochloride.
| Compound Name | N,2,2-trimethyl-N-phenylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 156708950 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.81 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N,2,2-trimethyl-N-phenylpiperidin-4-amine;hydrochloride |
| SMILES | CN(c1ccccc1)C1CCNC(C)(C)C1.Cl |
| InChI | InChI=1S/C14H22N2.ClH/c1-14(2)11-13(9-10-15-14)16(3)12-7-5-4-6-8-12;/h4-8,13,15H,9-11H2,1-3H3;1H |
| InChIKey | MVWOOJVVASTTSA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |