C18H25N3O — CID 11514934
1-methyl-5-[phenyl(3-pyrrolidin-1-ylpropoxy)methyl]pyrazole (PubChem CID 11514934) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-methyl-5-[phenyl(3-pyrrolidin-1-ylpropoxy)methyl]pyrazole.
| Compound Name | 1-methyl-5-[phenyl(3-pyrrolidin-1-ylpropoxy)methyl]pyrazole |
|---|---|
| PubChem CID | 11514934 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-methyl-5-[phenyl(3-pyrrolidin-1-ylpropoxy)methyl]pyrazole |
| SMILES | Cn1nccc1C(OCCCN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O/c1-20-17(10-11-19-20)18(16-8-3-2-4-9-16)22-15-7-14-21-12-5-6-13-21/h2-4,8-11,18H,5-7,12-15H2,1H3 |
| InChIKey | KKVQDWSUFYZWJA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|