C18H24ClN3O — CID 11566183
3-[(4-chlorophenyl)-(3-pyrrolidin-1-ylpropoxy)methyl]-1-methylpyrazole (PubChem CID 11566183) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-(3-pyrrolidin-1-ylpropoxy)methyl]-1-methylpyrazole.
| Compound Name | 3-[(4-chlorophenyl)-(3-pyrrolidin-1-ylpropoxy)methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 11566183 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-[(4-chlorophenyl)-(3-pyrrolidin-1-ylpropoxy)methyl]-1-methylpyrazole |
| SMILES | Cn1ccc(C(OCCCN2CCCC2)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H24ClN3O/c1-21-13-9-17(20-21)18(15-5-7-16(19)8-6-15)23-14-4-12-22-10-2-3-11-22/h5-9,13,18H,2-4,10-12,14H2,1H3 |
| InChIKey | RAYNEDVHURMPTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|