C20H33ClN2O2 — CID 7859092
(2R)-1-[3-(azepan-1-yl)propylamino]-3-[(1S)-1-(4-chlorophenyl)ethoxy]propan-2-ol (PubChem CID 7859092) has the molecular formula C20H33ClN2O2 and a molecular weight of 368.95 g/mol. Its IUPAC name is (2R)-1-[3-(azepan-1-yl)propylamino]-3-[(1S)-1-(4-chlorophenyl)ethoxy]propan-2-ol.
| Compound Name | (2R)-1-[3-(azepan-1-yl)propylamino]-3-[(1S)-1-(4-chlorophenyl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 7859092 |
| Molecular Formula | C20H33ClN2O2 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (2R)-1-[3-(azepan-1-yl)propylamino]-3-[(1S)-1-(4-chlorophenyl)ethoxy]propan-2-ol |
| SMILES | C[C@H](OC[C@H](O)CNCCCN1CCCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H33ClN2O2/c1-17(18-7-9-19(21)10-8-18)25-16-20(24)15-22-11-6-14-23-12-4-2-3-5-13-23/h7-10,17,20,22,24H,2-6,11-16H2,1H3/t17-,20+/m0/s1 |
| InChIKey | DNXUXQKZKCFGGZ-FXAWDEMLSA-N |
| XLogP | 3.63 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|