C27H30Cl2N2O3S — CID 46102582
1-[3-[bis(4-chlorophenyl)methoxy]propyl]-4-(2-methylphenyl)sulfonylpiperazine (PubChem CID 46102582) has the molecular formula C27H30Cl2N2O3S and a molecular weight of 533.52 g/mol. Its IUPAC name is 1-[3-[bis(4-chlorophenyl)methoxy]propyl]-4-(2-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-[3-[bis(4-chlorophenyl)methoxy]propyl]-4-(2-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 46102582 |
| Molecular Formula | C27H30Cl2N2O3S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 1-[3-[bis(4-chlorophenyl)methoxy]propyl]-4-(2-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCN(CCCOC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H30Cl2N2O3S/c1-21-5-2-3-6-26(21)35(32,33)31-18-16-30(17-19-31)15-4-20-34-27(22-7-11-24(28)12-8-22)23-9-13-25(29)14-10-23/h2-3,5-14,27H,4,15-20H2,1H3 |
| InChIKey | YVAVQWYKCSUPPH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|