C18H17FN2O2 — CID 11515145
2-(5-cyano-8-fluoro-1-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid (PubChem CID 11515145) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-(5-cyano-8-fluoro-1-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid.
| Compound Name | 2-(5-cyano-8-fluoro-1-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid |
|---|---|
| PubChem CID | 11515145 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-(5-cyano-8-fluoro-1-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid |
| SMILES | C=CCC1(CC(=O)O)CCCc2c1[nH]c1c(F)ccc(C#N)c21 |
| InChI | InChI=1S/C18H17FN2O2/c1-2-7-18(9-14(22)23)8-3-4-12-15-11(10-20)5-6-13(19)16(15)21-17(12)18/h2,5-6,21H,1,3-4,7-9H2,(H,22,23) |
| InChIKey | MVAKLMOVZGRJBK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|