C9H11BrN2OS — CID 115158767
N-(4-bromothiophen-2-yl)-N-methylazetidine-3-carboxamide (PubChem CID 115158767) has the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. Its IUPAC name is N-(4-bromothiophen-2-yl)-N-methylazetidine-3-carboxamide.
| Compound Name | N-(4-bromothiophen-2-yl)-N-methylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 115158767 |
| Molecular Formula | C9H11BrN2OS |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | N-(4-bromothiophen-2-yl)-N-methylazetidine-3-carboxamide |
| SMILES | CN(C(=O)C1CNC1)c1cc(Br)cs1 |
| InChI | InChI=1S/C9H11BrN2OS/c1-12(8-2-7(10)5-14-8)9(13)6-3-11-4-6/h2,5-6,11H,3-4H2,1H3 |
| InChIKey | WZCRQGIKQROPRL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |