C10H11BrN2OS — CID 115175042
N-(4-bromothiophen-2-yl)-2-cyano-N,2-dimethylpropanamide (PubChem CID 115175042) has the molecular formula C10H11BrN2OS and a molecular weight of 287.18 g/mol. Its IUPAC name is N-(4-bromothiophen-2-yl)-2-cyano-N,2-dimethylpropanamide.
| Compound Name | N-(4-bromothiophen-2-yl)-2-cyano-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 115175042 |
| Molecular Formula | C10H11BrN2OS |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | N-(4-bromothiophen-2-yl)-2-cyano-N,2-dimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)C#N)c1cc(Br)cs1 |
| InChI | InChI=1S/C10H11BrN2OS/c1-10(2,6-12)9(14)13(3)8-4-7(11)5-15-8/h4-5H,1-3H3 |
| InChIKey | QBZPCNWBEDYYTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |