C9H12N2OS — CID 115159164
N-thiophen-2-ylpyrrolidine-2-carboxamide (PubChem CID 115159164) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is N-thiophen-2-ylpyrrolidine-2-carboxamide.
| Compound Name | N-thiophen-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 115159164 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-thiophen-2-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccs1)C1CCCN1 |
| InChI | InChI=1S/C9H12N2OS/c12-9(7-3-1-5-10-7)11-8-4-2-6-13-8/h2,4,6-7,10H,1,3,5H2,(H,11,12) |
| InChIKey | IUMVNRVOCHQZLJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |