C13H13BrN2OS — CID 115161035
4-amino-N-[2-(4-bromothiophen-2-yl)ethyl]benzamide (PubChem CID 115161035) has the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. Its IUPAC name is 4-amino-N-[2-(4-bromothiophen-2-yl)ethyl]benzamide.
| Compound Name | 4-amino-N-[2-(4-bromothiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 115161035 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 4-amino-N-[2-(4-bromothiophen-2-yl)ethyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCCc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C13H13BrN2OS/c14-10-7-12(18-8-10)5-6-16-13(17)9-1-3-11(15)4-2-9/h1-4,7-8H,5-6,15H2,(H,16,17) |
| InChIKey | UAKULTARZRYOAN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|