C13H10BrN3OS — CID 115116565
N-[2-(4-bromothiophen-2-yl)ethyl]-6-cyanopyridine-2-carboxamide (PubChem CID 115116565) has the molecular formula C13H10BrN3OS and a molecular weight of 336.21 g/mol. Its IUPAC name is N-[2-(4-bromothiophen-2-yl)ethyl]-6-cyanopyridine-2-carboxamide.
| Compound Name | N-[2-(4-bromothiophen-2-yl)ethyl]-6-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 115116565 |
| Molecular Formula | C13H10BrN3OS |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | N-[2-(4-bromothiophen-2-yl)ethyl]-6-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1cccc(C(=O)NCCc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C13H10BrN3OS/c14-9-6-11(19-8-9)4-5-16-13(18)12-3-1-2-10(7-15)17-12/h1-3,6,8H,4-5H2,(H,16,18) |
| InChIKey | QSKVWZRREWRLGU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |