C11H17BrN2OS — CID 115155059
3-amino-N-[2-(4-bromothiophen-2-yl)ethyl]-3-methylbutanamide (PubChem CID 115155059) has the molecular formula C11H17BrN2OS and a molecular weight of 305.24 g/mol. Its IUPAC name is 3-amino-N-[2-(4-bromothiophen-2-yl)ethyl]-3-methylbutanamide.
| Compound Name | 3-amino-N-[2-(4-bromothiophen-2-yl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 115155059 |
| Molecular Formula | C11H17BrN2OS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 3-amino-N-[2-(4-bromothiophen-2-yl)ethyl]-3-methylbutanamide |
| SMILES | CC(C)(N)CC(=O)NCCc1cc(Br)cs1 |
| InChI | InChI=1S/C11H17BrN2OS/c1-11(2,13)6-10(15)14-4-3-9-5-8(12)7-16-9/h5,7H,3-4,6,13H2,1-2H3,(H,14,15) |
| InChIKey | MBYIAYAZOFTKIU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |