C14H21NOS — CID 115168067
N-[2-(2,5-dimethylphenyl)ethyl]-N-methyl-3-sulfanylpropanamide (PubChem CID 115168067) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenyl)ethyl]-N-methyl-3-sulfanylpropanamide.
| Compound Name | N-[2-(2,5-dimethylphenyl)ethyl]-N-methyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 115168067 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[2-(2,5-dimethylphenyl)ethyl]-N-methyl-3-sulfanylpropanamide |
| SMILES | Cc1ccc(C)c(CCN(C)C(=O)CCS)c1 |
| InChI | InChI=1S/C14H21NOS/c1-11-4-5-12(2)13(10-11)6-8-15(3)14(16)7-9-17/h4-5,10,17H,6-9H2,1-3H3 |
| InChIKey | JGCCBBLDWJAYJV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|