C14H21NOS — CID 115167953
N-methyl-3-sulfanyl-N-[(2,4,5-trimethylphenyl)methyl]propanamide (PubChem CID 115167953) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is N-methyl-3-sulfanyl-N-[(2,4,5-trimethylphenyl)methyl]propanamide.
| Compound Name | N-methyl-3-sulfanyl-N-[(2,4,5-trimethylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 115167953 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-methyl-3-sulfanyl-N-[(2,4,5-trimethylphenyl)methyl]propanamide |
| SMILES | Cc1cc(C)c(CN(C)C(=O)CCS)cc1C |
| InChI | InChI=1S/C14H21NOS/c1-10-7-12(3)13(8-11(10)2)9-15(4)14(16)5-6-17/h7-8,17H,5-6,9H2,1-4H3 |
| InChIKey | VRZMFMFADKERTR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|