C15H23NOS — CID 115168083
N-methyl-3-sulfanyl-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide (PubChem CID 115168083) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is N-methyl-3-sulfanyl-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide.
| Compound Name | N-methyl-3-sulfanyl-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 115168083 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-methyl-3-sulfanyl-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cc(C)c(CCN(C)C(=O)CCS)c(C)c1 |
| InChI | InChI=1S/C15H23NOS/c1-11-9-12(2)14(13(3)10-11)5-7-16(4)15(17)6-8-18/h9-10,18H,5-8H2,1-4H3 |
| InChIKey | KXSCARBMCKMZJY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|