C11H15NO2S — CID 172787778
(2,4-dimethyl-5-sulfanylphenyl)methyl-methylcarbamic acid (PubChem CID 172787778) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (2,4-dimethyl-5-sulfanylphenyl)methyl-methylcarbamic acid.
| Compound Name | (2,4-dimethyl-5-sulfanylphenyl)methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 172787778 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2,4-dimethyl-5-sulfanylphenyl)methyl-methylcarbamic acid |
| SMILES | Cc1cc(C)c(CN(C)C(=O)O)cc1S |
| InChI | InChI=1S/C11H15NO2S/c1-7-4-8(2)10(15)5-9(7)6-12(3)11(13)14/h4-5,15H,6H2,1-3H3,(H,13,14) |
| InChIKey | PDFLFMVCHFENFM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|